| Name | 2,4,6-Trimethylbenzoyl chloride |
| Synonyms | TMBC MESITOYL CHLORIDE Mesitoyl chloride Mesitylcarbonylchloride 2,4,6-trmethylbenzoyl chloride 2,4,6-Trimethylbenzoyl cloride 2,4,6-Trimethylbenzoyl chloride 2,4,6-TRIMETHYLBENZOYL CHLORIDE 2,4,6-Trimethyl benzoyl chloride BENZOYL CHLORIDE, 2,4,6-TRIMETHYL- Mesitoyl chloride~Mesitylene-2-carbonyl chloride Benzoyl chloride, 2,4,6-trimethyl- (6CI,7CI,8CI,9CI) |
| CAS | 938-18-1 |
| EINECS | 213-339-6 |
| InChI | InChI=1/C10H11ClO/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3 |
| Molecular Formula | C10H11ClO |
| Molar Mass | 182.65 |
| Density | 1.095 g/mL at 25 °C |
| Boling Point | 143-146 °C (60 mmHg) |
| Flash Point | 143-146°C/60mm |
| Water Solubility | Reacts slowly with water. |
| Vapor Presure | 1.52Pa at 25℃ |
| Appearance | Liquid |
| Color | Clear light yellow |
| BRN | 776108 |
| Storage Condition | 2-8°C |
| Sensitive | Moisture Sensitive |
| Refractive Index | 1.528-1.53 |
| Physical and Chemical Properties | Colorless liquid. |
| Use | Used as an additive for plastics and inks |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | 1760 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Hazard Class | 8 |
| Packing Group | II |
| LogP | 2.42-3.65 at 25℃ |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Use | organic synthesis intermediates. used as an additive for plastics and inks |